About 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile
2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile (PubChem CID 10892521) has the molecular formula C15H19ClN4Si
and a molecular weight of 318.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile |
| PubChem CID | 10892521 |
| Molecular Formula | C15H19ClN4Si |
| Molecular Weight | 318.88 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile |
| SMILES | C[Si](C)(C)CC(C#N)(Cn1cncn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClN4Si/c1-21(2,3)10-15(8-17,9-20-12-18-11-19-20)13-4-6-14(16)7-5-13/h4-7,11-12H,9-10H2,1-3H3 |
| InChIKey | RILCWNBELLITRQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile?
The IUPAC name of 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile (CID 10892521) is 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile.
What is the SMILES notation for 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile?
The canonical SMILES for 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile is C[Si](C)(C)CC(C#N)(Cn1cncn1)c1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile?
The InChIKey is RILCWNBELLITRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClN4Si/c1-21(2,3)10-15(8-17,9-20-12-18-11-19-20)13-4-6-14(16)7-5-13/h4-7,11-12H,9-10H2,1-3H3.
What are the key properties of 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile?
2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile has a molecular weight of 318.88 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-3-trimethylsilylpropanenitrile is sourced from PubChem (CID 10892521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).