C23H23N3O3 — CID 108925738
N-[[4-[3-(3-methoxyphenyl)propanoylamino]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 108925738) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[[4-[3-(3-methoxyphenyl)propanoylamino]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[4-[3-(3-methoxyphenyl)propanoylamino]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108925738 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[[4-[3-(3-methoxyphenyl)propanoylamino]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | COc1cccc(CCC(=O)Nc2ccc(CNC(=O)c3cccnc3)cc2)c1 |
| InChI | InChI=1S/C23H23N3O3/c1-29-21-6-2-4-17(14-21)9-12-22(27)26-20-10-7-18(8-11-20)15-25-23(28)19-5-3-13-24-16-19/h2-8,10-11,13-14,16H,9,12,15H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | YNWLFBOAKPYBMN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |