C17H22O4S — CID 10892628
(1R,2R,6S,7S,9S)-2,4,4,7-tetramethyl-3,5-dioxa-10λ6-thiatetracyclo[7.7.0.02,6.011,16]hexadeca-11,13,15-triene 10,10-dioxide (PubChem CID 10892628) has the molecular formula C17H22O4S and a molecular weight of 322.43 g/mol. Its IUPAC name is (1R,2R,6S,7S,9S)-2,4,4,7-tetramethyl-3,5-dioxa-10λ6-thiatetracyclo[7.7.0.02,6.011,16]hexadeca-11,13,15-triene 10,10-dioxide.
| Compound Name | (1R,2R,6S,7S,9S)-2,4,4,7-tetramethyl-3,5-dioxa-10λ6-thiatetracyclo[7.7.0.02,6.011,16]hexadeca-11,13,15-triene 10,10-dioxide |
|---|---|
| PubChem CID | 10892628 |
| Molecular Formula | C17H22O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (1R,2R,6S,7S,9S)-2,4,4,7-tetramethyl-3,5-dioxa-10λ6-thiatetracyclo[7.7.0.02,6.011,16]hexadeca-11,13,15-triene 10,10-dioxide |
| SMILES | C[C@H]1C[C@H]2[C@H](c3ccccc3S2(=O)=O)[C@@]2(C)OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C17H22O4S/c1-10-9-13-14(17(4)15(10)20-16(2,3)21-17)11-7-5-6-8-12(11)22(13,18)19/h5-8,10,13-15H,9H2,1-4H3/t10-,13-,14-,15-,17+/m0/s1 |
| InChIKey | LMUFGUVXJNHYDH-JZFARQHMSA-N |
| XLogP | 2.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |