C23H23N3O4 — CID 108926398
N-[[3-[[2-(4-ethoxyphenoxy)acetyl]amino]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 108926398) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[[3-[[2-(4-ethoxyphenoxy)acetyl]amino]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[3-[[2-(4-ethoxyphenoxy)acetyl]amino]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108926398 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-[[3-[[2-(4-ethoxyphenoxy)acetyl]amino]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | CCOc1ccc(OCC(=O)Nc2cccc(CNC(=O)c3cccnc3)c2)cc1 |
| InChI | InChI=1S/C23H23N3O4/c1-2-29-20-8-10-21(11-9-20)30-16-22(27)26-19-7-3-5-17(13-19)14-25-23(28)18-6-4-12-24-15-18/h3-13,15H,2,14,16H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | LILWXEDPBMRHDT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |