C21H9NO3 — CID 10892649
1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene-8,14,22-trione (PubChem CID 10892649) has the molecular formula C21H9NO3 and a molecular weight of 323.31 g/mol. Its IUPAC name is 1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene-8,14,22-trione.
| Compound Name | 1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene-8,14,22-trione |
|---|---|
| PubChem CID | 10892649 |
| Molecular Formula | C21H9NO3 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene-8,14,22-trione |
| SMILES | O=c1c2cccc3c(=O)c4cccc5c(=O)c6cccc1c6n(c23)c45 |
| InChI | InChI=1S/C21H9NO3/c23-19-10-4-1-5-11-16(10)22-17-12(19)6-2-8-14(17)21(25)15-9-3-7-13(18(15)22)20(11)24/h1-9H |
| InChIKey | IMRRNSVROUUREO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|