C20H21NO3 — CID 10892656
(3S)-2-benzyl-3-[(1R)-1-phenylmethoxyprop-2-enyl]-1,2-oxazolidin-5-one (PubChem CID 10892656) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (3S)-2-benzyl-3-[(1R)-1-phenylmethoxyprop-2-enyl]-1,2-oxazolidin-5-one.
| Compound Name | (3S)-2-benzyl-3-[(1R)-1-phenylmethoxyprop-2-enyl]-1,2-oxazolidin-5-one |
|---|---|
| PubChem CID | 10892656 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (3S)-2-benzyl-3-[(1R)-1-phenylmethoxyprop-2-enyl]-1,2-oxazolidin-5-one |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@@H]1CC(=O)ON1Cc1ccccc1 |
| InChI | InChI=1S/C20H21NO3/c1-2-19(23-15-17-11-7-4-8-12-17)18-13-20(22)24-21(18)14-16-9-5-3-6-10-16/h2-12,18-19H,1,13-15H2/t18-,19+/m0/s1 |
| InChIKey | OLYCKTURAKRBRF-RBUKOAKNSA-N |
| XLogP | 3.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|