C16H24N2O5 — CID 10892684
tert-butyl (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 10892684) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 10892684 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)CO |
| InChI | InChI=1S/C16H24N2O5/c1-16(2,3)23-15(22)13(18-14(21)12(17)9-19)8-10-4-6-11(20)7-5-10/h4-7,12-13,19-20H,8-9,17H2,1-3H3,(H,18,21)/t12-,13-/m0/s1 |
| InChIKey | HSDNPTSUYSNHCK-STQMWFEESA-N |
| XLogP | 0.08 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |