Cyclohexane, hexakis(1-methylethylidene)-

C24H36 — CID 10892708

IUPAC1,2,3,4,5,6-hexa(propan-2-ylidene)cyclohexane
SMILESCC(=C1C(=C(C)C)C(=C(C)C)C(=C(C)C)C(=C(C)C)C1=C(C)C)C
InChIInChI=1S/C24H36/c1-13(2)19-20(14(3)4)22(16(7)8)24(18(11)12)23(17(9)10)21(19)15(5)6/h1-12H3
InChIKeyOWJVFSPGHSNLQK-UHFFFAOYSA-N
MW324.50 g/mol
LogP7.50
Rot. Bonds

About Cyclohexane, hexakis(1-methylethylidene)-

Cyclohexane, hexakis(1-methylethylidene)- (PubChem CID 10892708) has the molecular formula C24H36 and a molecular weight of 324.50 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexa(propan-2-ylidene)cyclohexane.

Molecular Properties

Compound NameCyclohexane, hexakis(1-methylethylidene)-
PubChem CID10892708
Molecular FormulaC24H36
Molecular Weight324.50 g/mol
Exact Mass324.28
IUPAC Name1,2,3,4,5,6-hexa(propan-2-ylidene)cyclohexane
SMILESCC(=C1C(=C(C)C)C(=C(C)C)C(=C(C)C)C(=C(C)C)C1=C(C)C)C
InChIInChI=1S/C24H36/c1-13(2)19-20(14(3)4)22(16(7)8)24(18(11)12)23(17(9)10)21(19)15(5)6/h1-12H3
InChIKeyOWJVFSPGHSNLQK-UHFFFAOYSA-N
XLogP7.50
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms24
Complexity531

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500324.50
LogP ≤ 57.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze Cyclohexane, hexakis(1-methylethylidene)- with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of Cyclohexane, hexakis(1-methylethylidene)-?
The IUPAC name of Cyclohexane, hexakis(1-methylethylidene)- (CID 10892708) is 1,2,3,4,5,6-hexa(propan-2-ylidene)cyclohexane.
What is the SMILES notation for Cyclohexane, hexakis(1-methylethylidene)-?
The canonical SMILES for Cyclohexane, hexakis(1-methylethylidene)- is CC(=C1C(=C(C)C)C(=C(C)C)C(=C(C)C)C(=C(C)C)C1=C(C)C)C.
What is the InChIKey of Cyclohexane, hexakis(1-methylethylidene)-?
The InChIKey is OWJVFSPGHSNLQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H36/c1-13(2)19-20(14(3)4)22(16(7)8)24(18(11)12)23(17(9)10)21(19)15(5)6/h1-12H3.
What are the key properties of Cyclohexane, hexakis(1-methylethylidene)-?
Cyclohexane, hexakis(1-methylethylidene)- has a molecular weight of 324.50 g/mol, XLogP of 7.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Cyclohexane, hexakis(1-methylethylidene)- is sourced from PubChem (CID 10892708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).