About Cyclohexane, hexakis(1-methylethylidene)-
Cyclohexane, hexakis(1-methylethylidene)- (PubChem CID 10892708) has the molecular formula C24H36
and a molecular weight of 324.50 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexa(propan-2-ylidene)cyclohexane.
Molecular Properties
| Compound Name | Cyclohexane, hexakis(1-methylethylidene)- |
| PubChem CID | 10892708 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 1,2,3,4,5,6-hexa(propan-2-ylidene)cyclohexane |
| SMILES | CC(=C1C(=C(C)C)C(=C(C)C)C(=C(C)C)C(=C(C)C)C1=C(C)C)C |
| InChI | InChI=1S/C24H36/c1-13(2)19-20(14(3)4)22(16(7)8)24(18(11)12)23(17(9)10)21(19)15(5)6/h1-12H3 |
| InChIKey | OWJVFSPGHSNLQK-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | 531 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Cyclohexane, hexakis(1-methylethylidene)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cyclohexane, hexakis(1-methylethylidene)-?
The IUPAC name of Cyclohexane, hexakis(1-methylethylidene)- (CID 10892708) is 1,2,3,4,5,6-hexa(propan-2-ylidene)cyclohexane.
What is the SMILES notation for Cyclohexane, hexakis(1-methylethylidene)-?
The canonical SMILES for Cyclohexane, hexakis(1-methylethylidene)- is CC(=C1C(=C(C)C)C(=C(C)C)C(=C(C)C)C(=C(C)C)C1=C(C)C)C.
What is the InChIKey of Cyclohexane, hexakis(1-methylethylidene)-?
The InChIKey is OWJVFSPGHSNLQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H36/c1-13(2)19-20(14(3)4)22(16(7)8)24(18(11)12)23(17(9)10)21(19)15(5)6/h1-12H3.
What are the key properties of Cyclohexane, hexakis(1-methylethylidene)-?
Cyclohexane, hexakis(1-methylethylidene)- has a molecular weight of 324.50 g/mol, XLogP of 7.50, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Cyclohexane, hexakis(1-methylethylidene)- is sourced from PubChem (CID 10892708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).