C19H19NO4 — CID 10892724
4-[4-(tert-butylcarbamoyl)benzoyl]benzoic acid (PubChem CID 10892724) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 4-[4-(tert-butylcarbamoyl)benzoyl]benzoic acid.
| Compound Name | 4-[4-(tert-butylcarbamoyl)benzoyl]benzoic acid |
|---|---|
| PubChem CID | 10892724 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 4-[4-(tert-butylcarbamoyl)benzoyl]benzoic acid |
| SMILES | CC(C)(C)NC(=O)c1ccc(C(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H19NO4/c1-19(2,3)20-17(22)14-8-4-12(5-9-14)16(21)13-6-10-15(11-7-13)18(23)24/h4-11H,1-3H3,(H,20,22)(H,23,24) |
| InChIKey | YYEAJEMHFHQTEL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |