C27H28N2O5 — CID 108927645
[3-[[4-[2-(4-propan-2-ylphenoxy)propanoylamino]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108927645) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is [3-[[4-[2-(4-propan-2-ylphenoxy)propanoylamino]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[4-[2-(4-propan-2-ylphenoxy)propanoylamino]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927645 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | [3-[[4-[2-(4-propan-2-ylphenoxy)propanoylamino]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2ccc(NC(=O)C(C)Oc3ccc(C(C)C)cc3)cc2)c1 |
| InChI | InChI=1S/C27H28N2O5/c1-17(2)20-8-14-24(15-9-20)33-18(3)26(31)28-22-10-12-23(13-11-22)29-27(32)21-6-5-7-25(16-21)34-19(4)30/h5-18H,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | MHZHDMZLJSPCGT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|