C17H32O4Si — CID 10892812
(E)-3-[(1R,3R,4R)-3-methoxy-4-(2-trimethylsilylethoxymethoxy)cyclohexyl]-2-methylprop-2-enal (PubChem CID 10892812) has the molecular formula C17H32O4Si and a molecular weight of 328.52 g/mol. Its IUPAC name is (E)-3-[(1R,3R,4R)-3-methoxy-4-(2-trimethylsilylethoxymethoxy)cyclohexyl]-2-methylprop-2-enal.
| Compound Name | (E)-3-[(1R,3R,4R)-3-methoxy-4-(2-trimethylsilylethoxymethoxy)cyclohexyl]-2-methylprop-2-enal |
|---|---|
| PubChem CID | 10892812 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (E)-3-[(1R,3R,4R)-3-methoxy-4-(2-trimethylsilylethoxymethoxy)cyclohexyl]-2-methylprop-2-enal |
| SMILES | CO[C@@H]1C[C@H](/C=C(\C)C=O)CC[C@H]1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C17H32O4Si/c1-14(12-18)10-15-6-7-16(17(11-15)19-2)21-13-20-8-9-22(3,4)5/h10,12,15-17H,6-9,11,13H2,1-5H3/b14-10+/t15-,16+,17+/m0/s1 |
| InChIKey | DPMHHUPZVHRRHC-IJFIETPASA-N |
| XLogP | 3.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|