About carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium
carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium (PubChem CID 10892893) has the molecular formula C13H13CrNO6
and a molecular weight of 331.24 g/mol. Its IUPAC name is carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium.
Molecular Properties
| Compound Name | carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium |
| PubChem CID | 10892893 |
| Molecular Formula | C13H13CrNO6 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium |
| SMILES | CN(C)C1=CC(=[Cr])OC1(C)C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C8H13NO.5CO.Cr/c1-8(2)7(9(3)4)5-6-10-8;5*1-2;/h5H,1-4H3;;;;;; |
| InChIKey | XNCDRKOZEGMBNC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 111.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium?
The IUPAC name of carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium (CID 10892893) is carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium.
What is the SMILES notation for carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium?
The canonical SMILES for carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium is CN(C)C1=CC(=[Cr])OC1(C)C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].
What is the InChIKey of carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium?
The InChIKey is XNCDRKOZEGMBNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO.5CO.Cr/c1-8(2)7(9(3)4)5-6-10-8;5*1-2;/h5H,1-4H3;;;;;;.
What are the key properties of carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium?
carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium has a molecular weight of 331.24 g/mol, XLogP of 0.73, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;[4-(dimethylamino)-5,5-dimethylfuran-2-ylidene]chromium is sourced from PubChem (CID 10892893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).