C17H21NO4S — CID 10893030
ethyl 2-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]pent-4-enoate (PubChem CID 10893030) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is ethyl 2-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]pent-4-enoate.
| Compound Name | ethyl 2-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]pent-4-enoate |
|---|---|
| PubChem CID | 10893030 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | ethyl 2-[(4-methylphenyl)sulfonyl-prop-2-ynylamino]pent-4-enoate |
| SMILES | C#CCN(C(CC=C)C(=O)OCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H21NO4S/c1-5-8-16(17(19)22-7-3)18(13-6-2)23(20,21)15-11-9-14(4)10-12-15/h2,5,9-12,16H,1,7-8,13H2,3-4H3 |
| InChIKey | OIEJGTDALZCQSH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|