C29H38N2O6 — CID 108930368
[4-[[1-[4-(4-tert-butylphenoxy)butanoyl]piperidin-4-yl]carbamoyl]phenyl] ethyl carbonate (PubChem CID 108930368) has the molecular formula C29H38N2O6 and a molecular weight of 510.63 g/mol. Its IUPAC name is [4-[[1-[4-(4-tert-butylphenoxy)butanoyl]piperidin-4-yl]carbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[1-[4-(4-tert-butylphenoxy)butanoyl]piperidin-4-yl]carbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108930368 |
| Molecular Formula | C29H38N2O6 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | [4-[[1-[4-(4-tert-butylphenoxy)butanoyl]piperidin-4-yl]carbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NC2CCN(C(=O)CCCOc3ccc(C(C)(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H38N2O6/c1-5-35-28(34)37-25-12-8-21(9-13-25)27(33)30-23-16-18-31(19-17-23)26(32)7-6-20-36-24-14-10-22(11-15-24)29(2,3)4/h8-15,23H,5-7,16-20H2,1-4H3,(H,30,33) |
| InChIKey | NHOVBCXBYOKLCD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|