C19H34O3Si — CID 10893132
(1R,5S)-9-acetyl-1-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethylspiro[4.4]nonan-4-one (PubChem CID 10893132) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is (1R,5S)-9-acetyl-1-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethylspiro[4.4]nonan-4-one.
| Compound Name | (1R,5S)-9-acetyl-1-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethylspiro[4.4]nonan-4-one |
|---|---|
| PubChem CID | 10893132 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | (1R,5S)-9-acetyl-1-[tert-butyl(dimethyl)silyl]oxy-7,7-dimethylspiro[4.4]nonan-4-one |
| SMILES | CC(=O)C1CC(C)(C)C[C@]12C(=O)CC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O3Si/c1-13(20)14-11-18(5,6)12-19(14)15(21)9-10-16(19)22-23(7,8)17(2,3)4/h14,16H,9-12H2,1-8H3/t14?,16-,19-/m1/s1 |
| InChIKey | HPJRKSYHIDURFC-JDQGPONISA-N |
| XLogP | 4.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|