About 2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one
2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 108932492) has the molecular formula C10H13F3N2O2
and a molecular weight of 250.22 g/mol. Its IUPAC name is 2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one.
Molecular Properties
| Compound Name | 2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one |
| PubChem CID | 108932492 |
| Molecular Formula | C10H13F3N2O2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=C(C)C(=O)N1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H13F3N2O2/c1-7(2)8(16)14-3-5-15(6-4-14)9(17)10(11,12)13/h1,3-6H2,2H3 |
| InChIKey | PKTHHEZZLVEWRO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one?
The IUPAC name of 2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one (CID 108932492) is 2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one.
What is the SMILES notation for 2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one?
The canonical SMILES for 2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one is C=C(C)C(=O)N1CCN(C(=O)C(F)(F)F)CC1.
What is the InChIKey of 2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one?
The InChIKey is PKTHHEZZLVEWRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3N2O2/c1-7(2)8(16)14-3-5-15(6-4-14)9(17)10(11,12)13/h1,3-6H2,2H3.
What are the key properties of 2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one?
2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one has a molecular weight of 250.22 g/mol, XLogP of 0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]prop-2-en-1-one is sourced from PubChem (CID 108932492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).