C14H19F3N2O3 — CID 108932572
2,2,2-trifluoro-1-[4-[2-(oxan-4-ylidene)acetyl]-1,4-diazepan-1-yl]ethanone (PubChem CID 108932572) has the molecular formula C14H19F3N2O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[2-(oxan-4-ylidene)acetyl]-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-[2-(oxan-4-ylidene)acetyl]-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 108932572 |
| Molecular Formula | C14H19F3N2O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[2-(oxan-4-ylidene)acetyl]-1,4-diazepan-1-yl]ethanone |
| SMILES | O=C(C=C1CCOCC1)N1CCCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H19F3N2O3/c15-14(16,17)13(21)19-5-1-4-18(6-7-19)12(20)10-11-2-8-22-9-3-11/h10H,1-9H2 |
| InChIKey | KXZYLFVNAKGHGV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|