C18H21F3N2O2 — CID 108932915
2,2,2-trifluoro-N-[[1-[(E)-3-(4-methylphenyl)prop-2-enoyl]piperidin-4-yl]methyl]acetamide (PubChem CID 108932915) has the molecular formula C18H21F3N2O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[1-[(E)-3-(4-methylphenyl)prop-2-enoyl]piperidin-4-yl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[1-[(E)-3-(4-methylphenyl)prop-2-enoyl]piperidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 108932915 |
| Molecular Formula | C18H21F3N2O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[[1-[(E)-3-(4-methylphenyl)prop-2-enoyl]piperidin-4-yl]methyl]acetamide |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCC(CNC(=O)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C18H21F3N2O2/c1-13-2-4-14(5-3-13)6-7-16(24)23-10-8-15(9-11-23)12-22-17(25)18(19,20)21/h2-7,15H,8-12H2,1H3,(H,22,25)/b7-6+ |
| InChIKey | IKSYRSLMAAUMDS-VOTSOKGWSA-N |
| XLogP | 2.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|