C16H12BrF3N2O2 — CID 108934015
2-bromo-N-[2-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]benzamide (PubChem CID 108934015) has the molecular formula C16H12BrF3N2O2 and a molecular weight of 401.18 g/mol. Its IUPAC name is 2-bromo-N-[2-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]benzamide.
| Compound Name | 2-bromo-N-[2-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 108934015 |
| Molecular Formula | C16H12BrF3N2O2 |
| Molecular Weight | 401.18 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 2-bromo-N-[2-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1CNC(=O)C(F)(F)F)c1ccccc1Br |
| InChI | InChI=1S/C16H12BrF3N2O2/c17-12-7-3-2-6-11(12)14(23)22-13-8-4-1-5-10(13)9-21-15(24)16(18,19)20/h1-8H,9H2,(H,21,24)(H,22,23) |
| InChIKey | RGPJWINOTKYTOF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.18 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |