C19H17BrClF3N2O3 — CID 108934111
4-(4-bromo-2-chlorophenoxy)-N-[2-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]butanamide (PubChem CID 108934111) has the molecular formula C19H17BrClF3N2O3 and a molecular weight of 493.71 g/mol. Its IUPAC name is 4-(4-bromo-2-chlorophenoxy)-N-[2-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]butanamide.
| Compound Name | 4-(4-bromo-2-chlorophenoxy)-N-[2-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 108934111 |
| Molecular Formula | C19H17BrClF3N2O3 |
| Molecular Weight | 493.71 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | 4-(4-bromo-2-chlorophenoxy)-N-[2-[[(2,2,2-trifluoroacetyl)amino]methyl]phenyl]butanamide |
| SMILES | O=C(CCCOc1ccc(Br)cc1Cl)Nc1ccccc1CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H17BrClF3N2O3/c20-13-7-8-16(14(21)10-13)29-9-3-6-17(27)26-15-5-2-1-4-12(15)11-25-18(28)19(22,23)24/h1-2,4-5,7-8,10H,3,6,9,11H2,(H,25,28)(H,26,27) |
| InChIKey | BDRUGEATBWSMMB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.71 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|