C16H12F4N2O2 — CID 108934210
3-fluoro-N-[[2-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]benzamide (PubChem CID 108934210) has the molecular formula C16H12F4N2O2 and a molecular weight of 340.28 g/mol. Its IUPAC name is 3-fluoro-N-[[2-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]benzamide.
| Compound Name | 3-fluoro-N-[[2-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 108934210 |
| Molecular Formula | C16H12F4N2O2 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 3-fluoro-N-[[2-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccccc1NC(=O)C(F)(F)F)c1cccc(F)c1 |
| InChI | InChI=1S/C16H12F4N2O2/c17-12-6-3-5-10(8-12)14(23)21-9-11-4-1-2-7-13(11)22-15(24)16(18,19)20/h1-8H,9H2,(H,21,23)(H,22,24) |
| InChIKey | RZMLQFSKXDTLLO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |