C10H11F3N4O3 — CID 108934838
6-oxo-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]-1H-pyridazine-3-carboxamide (PubChem CID 108934838) has the molecular formula C10H11F3N4O3 and a molecular weight of 292.22 g/mol. Its IUPAC name is 6-oxo-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]-1H-pyridazine-3-carboxamide.
| Compound Name | 6-oxo-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 108934838 |
| Molecular Formula | C10H11F3N4O3 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 6-oxo-N-[3-[(2,2,2-trifluoroacetyl)amino]propyl]-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NCCCNC(=O)C(F)(F)F)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C10H11F3N4O3/c11-10(12,13)9(20)15-5-1-4-14-8(19)6-2-3-7(18)17-16-6/h2-3H,1,4-5H2,(H,14,19)(H,15,20)(H,17,18) |
| InChIKey | PIAHUVBBCMTTPP-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|