About trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide
trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide (PubChem CID 10893528) has the molecular formula C11H12ClN3O
and a molecular weight of 237.69 g/mol. Its IUPAC name is trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide |
| PubChem CID | 10893528 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide |
| SMILES | NC(N)=NC(=O)[C@H]1C[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClN3O/c12-7-3-1-6(2-4-7)8-5-9(8)10(16)15-11(13)14/h1-4,8-9H,5H2,(H4,13,14,15,16)/t8-,9+/m1/s1 |
| InChIKey | NHTKZBXLGXRHGA-BDAKNGLRSA-N |
| XLogP | 1.24 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide?
The IUPAC name of trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide (CID 10893528) is trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide.
What is the SMILES notation for trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide?
The canonical SMILES for trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide is NC(N)=NC(=O)[C@H]1C[C@@H]1c1ccc(Cl)cc1.
What is the InChIKey of trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide?
The InChIKey is NHTKZBXLGXRHGA-BDAKNGLRSA-N. The full InChI is InChI=1S/C11H12ClN3O/c12-7-3-1-6(2-4-7)8-5-9(8)10(16)15-11(13)14/h1-4,8-9H,5H2,(H4,13,14,15,16)/t8-,9+/m1/s1.
What are the key properties of trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide?
trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide has a molecular weight of 237.69 g/mol, XLogP of 1.24, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-2-(4-chlorophenyl)-N-(diaminomethylidene)cyclopropane-1-carboxamide is sourced from PubChem (CID 10893528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).