C21H25NO2S — CID 10893631
(3R,4S)-2-cyclohexyl-3-(4-methylphenyl)-4-phenylthiazetidine 1,1-dioxide (PubChem CID 10893631) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is (3R,4S)-2-cyclohexyl-3-(4-methylphenyl)-4-phenylthiazetidine 1,1-dioxide.
| Compound Name | (3R,4S)-2-cyclohexyl-3-(4-methylphenyl)-4-phenylthiazetidine 1,1-dioxide |
|---|---|
| PubChem CID | 10893631 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (3R,4S)-2-cyclohexyl-3-(4-methylphenyl)-4-phenylthiazetidine 1,1-dioxide |
| SMILES | Cc1ccc([C@@H]2[C@H](c3ccccc3)S(=O)(=O)N2C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H25NO2S/c1-16-12-14-17(15-13-16)20-21(18-8-4-2-5-9-18)25(23,24)22(20)19-10-6-3-7-11-19/h2,4-5,8-9,12-15,19-21H,3,6-7,10-11H2,1H3/t20-,21+/m1/s1 |
| InChIKey | SSSQVFMMODTUKU-RTWAWAEBSA-N |
| XLogP | 4.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |