C20H21NO3 — CID 108936557
(4E)-4-[(4-tert-butylphenyl)methylidene]-2-[2-(furan-2-yl)ethyl]-1,3-oxazol-5-one (PubChem CID 108936557) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (4E)-4-[(4-tert-butylphenyl)methylidene]-2-[2-(furan-2-yl)ethyl]-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(4-tert-butylphenyl)methylidene]-2-[2-(furan-2-yl)ethyl]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108936557 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (4E)-4-[(4-tert-butylphenyl)methylidene]-2-[2-(furan-2-yl)ethyl]-1,3-oxazol-5-one |
| SMILES | CC(C)(C)c1ccc(/C=C2/N=C(CCc3ccco3)OC2=O)cc1 |
| InChI | InChI=1S/C20H21NO3/c1-20(2,3)15-8-6-14(7-9-15)13-17-19(22)24-18(21-17)11-10-16-5-4-12-23-16/h4-9,12-13H,10-11H2,1-3H3/b17-13+ |
| InChIKey | WAVAQZGKXKWLAC-GHRIWEEISA-N |
| XLogP | 4.51 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|