About trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane
trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane (PubChem CID 10893658) has the molecular formula C20H24O2SSi
and a molecular weight of 356.56 g/mol. Its IUPAC name is trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane.
Molecular Properties
| Compound Name | trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane |
| PubChem CID | 10893658 |
| Molecular Formula | C20H24O2SSi |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane |
| SMILES | CC(=C=C([Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H24O2SSi/c1-16-11-13-19(14-12-16)23(21,22)20(24(3,4)5)15-17(2)18-9-7-6-8-10-18/h6-14H,1-5H3 |
| InChIKey | HKHWYHOHDXVHLB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane?
The IUPAC name of trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane (CID 10893658) is trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane.
What is the SMILES notation for trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane?
The canonical SMILES for trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane is CC(=C=C([Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1)c1ccccc1.
What is the InChIKey of trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane?
The InChIKey is HKHWYHOHDXVHLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O2SSi/c1-16-11-13-19(14-12-16)23(21,22)20(24(3,4)5)15-17(2)18-9-7-6-8-10-18/h6-14H,1-5H3.
What are the key properties of trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane?
trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane has a molecular weight of 356.56 g/mol, XLogP of 5.23, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[1-(4-methylphenyl)sulfonyl-3-phenylbuta-1,2-dienyl]silane is sourced from PubChem (CID 10893658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).