C19H24N2O3S — CID 10893758
3-[4-[[(2R)-2-amino-3-sulfanylpropyl]amino]-2-propoxyphenyl]benzoic acid (PubChem CID 10893758) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is 3-[4-[[(2R)-2-amino-3-sulfanylpropyl]amino]-2-propoxyphenyl]benzoic acid.
| Compound Name | 3-[4-[[(2R)-2-amino-3-sulfanylpropyl]amino]-2-propoxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 10893758 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 3-[4-[[(2R)-2-amino-3-sulfanylpropyl]amino]-2-propoxyphenyl]benzoic acid |
| SMILES | CCCOc1cc(NC[C@@H](N)CS)ccc1-c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C19H24N2O3S/c1-2-8-24-18-10-16(21-11-15(20)12-25)6-7-17(18)13-4-3-5-14(9-13)19(22)23/h3-7,9-10,15,21,25H,2,8,11-12,20H2,1H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | FSXYFJWXKIMVFY-OAHLLOKOSA-N |
| XLogP | 3.51 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|