C21H34O3Si — CID 10893826
(1R,9R,12R)-9-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-9-methyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,7-dien-3-one (PubChem CID 10893826) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is (1R,9R,12R)-9-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-9-methyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,7-dien-3-one.
| Compound Name | (1R,9R,12R)-9-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-9-methyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,7-dien-3-one |
|---|---|
| PubChem CID | 10893826 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (1R,9R,12R)-9-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-9-methyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,7-dien-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@]1(C)CC[C@H]2OC(=O)C3=CCC=C1[C@H]32 |
| InChI | InChI=1S/C21H34O3Si/c1-20(2,3)25(5,6)23-14-8-12-21(4)13-11-17-18-15(19(22)24-17)9-7-10-16(18)21/h9-10,17-18H,7-8,11-14H2,1-6H3/t17-,18+,21-/m1/s1 |
| InChIKey | OUIAAKIJJKDTSX-LVCYWYKZSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|