About CID 10893883
CID 10893883 (PubChem CID 10893883) has the molecular formula C22H18FeSi
and a molecular weight of 366.32 g/mol.
Molecular Properties
| Compound Name | CID 10893883 |
| PubChem CID | 10893883 |
| Molecular Formula | C22H18FeSi |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][C]([Si]([C]2[CH][CH][CH][CH]2)(c2ccccc2)c2ccccc2)[CH]1.[Fe] |
| InChI | InChI=1S/C22H18Si.Fe/c1-3-11-19(12-4-1)23(21-15-7-8-16-21,22-17-9-10-18-22)20-13-5-2-6-14-20;/h1-18H; |
| InChIKey | MJLNBMOUCROMOV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10893883 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10893883?
The IUPAC name of CID 10893883 (CID 10893883) is not available.
What is the SMILES notation for CID 10893883?
The canonical SMILES for CID 10893883 is [CH]1[CH][CH][C]([Si]([C]2[CH][CH][CH][CH]2)(c2ccccc2)c2ccccc2)[CH]1.[Fe].
What is the InChIKey of CID 10893883?
The InChIKey is MJLNBMOUCROMOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Si.Fe/c1-3-11-19(12-4-1)23(21-15-7-8-16-21,22-17-9-10-18-22)20-13-5-2-6-14-20;/h1-18H;.
What are the key properties of CID 10893883?
CID 10893883 has a molecular weight of 366.32 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10893883 is sourced from PubChem (CID 10893883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).