C18H29NO3SSi — CID 10893918
trans-(2R,6S)-2-[tert-butyl(dimethyl)silyl]-6-[(1S)-2-nitro-1-thiophen-2-ylethyl]cyclohexan-1-one (PubChem CID 10893918) has the molecular formula C18H29NO3SSi and a molecular weight of 367.59 g/mol. Its IUPAC name is trans-(2R,6S)-2-[tert-butyl(dimethyl)silyl]-6-[(1S)-2-nitro-1-thiophen-2-ylethyl]cyclohexan-1-one.
| Compound Name | trans-(2R,6S)-2-[tert-butyl(dimethyl)silyl]-6-[(1S)-2-nitro-1-thiophen-2-ylethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 10893918 |
| Molecular Formula | C18H29NO3SSi |
| Molecular Weight | 367.59 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | trans-(2R,6S)-2-[tert-butyl(dimethyl)silyl]-6-[(1S)-2-nitro-1-thiophen-2-ylethyl]cyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)[C@@H]1CCC[C@@H]([C@@H](C[N+](=O)[O-])c2cccs2)C1=O |
| InChI | InChI=1S/C18H29NO3SSi/c1-18(2,3)24(4,5)16-10-6-8-13(17(16)20)14(12-19(21)22)15-9-7-11-23-15/h7,9,11,13-14,16H,6,8,10,12H2,1-5H3/t13-,14+,16+/m0/s1 |
| InChIKey | RIRIWLQCXBZFFO-SQWLQELKSA-N |
| XLogP | 5.36 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|