About 4-iodophenol
4-iodophenol (PubChem CID 10894) has the molecular formula C6H5IO
and a molecular weight of 220.01 g/mol. Its IUPAC name is 4-iodophenol.
Molecular Properties
| Compound Name | 4-iodophenol |
| PubChem CID | 10894 |
| Molecular Formula | C6H5IO |
| Molecular Weight | 220.01 g/mol |
| Exact Mass | 219.94 |
| IUPAC Name | 4-iodophenol |
| SMILES | Oc1ccc(I)cc1 |
| InChI | InChI=1S/C6H5IO/c7-5-1-3-6(8)4-2-5/h1-4,8H |
| InChIKey | VSMDINRNYYEDRN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.01 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodophenol?
The IUPAC name of 4-iodophenol (CID 10894) is 4-iodophenol.
What is the SMILES notation for 4-iodophenol?
The canonical SMILES for 4-iodophenol is Oc1ccc(I)cc1.
What is the InChIKey of 4-iodophenol?
The InChIKey is VSMDINRNYYEDRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5IO/c7-5-1-3-6(8)4-2-5/h1-4,8H.
What are the key properties of 4-iodophenol?
4-iodophenol has a molecular weight of 220.01 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodophenol is sourced from PubChem (CID 10894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).