C10H18N2O3 — CID 108940973
N'-cyclopropyl-N-(3-methoxypropyl)propanediamide (PubChem CID 108940973) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is N'-cyclopropyl-N-(3-methoxypropyl)propanediamide.
| Compound Name | N'-cyclopropyl-N-(3-methoxypropyl)propanediamide |
|---|---|
| PubChem CID | 108940973 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N'-cyclopropyl-N-(3-methoxypropyl)propanediamide |
| SMILES | COCCCNC(=O)CC(=O)NC1CC1 |
| InChI | InChI=1S/C10H18N2O3/c1-15-6-2-5-11-9(13)7-10(14)12-8-3-4-8/h8H,2-7H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | PHZRPGVHSOFPOG-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|