C20H23ClN2O3 — CID 108941522
N-butyl-N'-[4-[(4-chlorophenyl)methoxy]phenyl]propanediamide (PubChem CID 108941522) has the molecular formula C20H23ClN2O3 and a molecular weight of 374.87 g/mol. Its IUPAC name is N-butyl-N'-[4-[(4-chlorophenyl)methoxy]phenyl]propanediamide.
| Compound Name | N-butyl-N'-[4-[(4-chlorophenyl)methoxy]phenyl]propanediamide |
|---|---|
| PubChem CID | 108941522 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-butyl-N'-[4-[(4-chlorophenyl)methoxy]phenyl]propanediamide |
| SMILES | CCCCNC(=O)CC(=O)Nc1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H23ClN2O3/c1-2-3-12-22-19(24)13-20(25)23-17-8-10-18(11-9-17)26-14-15-4-6-16(21)7-5-15/h4-11H,2-3,12-14H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | CSEVMEURBIKTII-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|