C13H16Cl2N2O2 — CID 108941910
N'-butan-2-yl-N-(2,4-dichlorophenyl)propanediamide (PubChem CID 108941910) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is N'-butan-2-yl-N-(2,4-dichlorophenyl)propanediamide.
| Compound Name | N'-butan-2-yl-N-(2,4-dichlorophenyl)propanediamide |
|---|---|
| PubChem CID | 108941910 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N'-butan-2-yl-N-(2,4-dichlorophenyl)propanediamide |
| SMILES | CCC(C)NC(=O)CC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-3-8(2)16-12(18)7-13(19)17-11-5-4-9(14)6-10(11)15/h4-6,8H,3,7H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | LMCDGJLVLNLYFF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|