C19H26N2O2 — CID 108942003
1-(4-benzylpiperidin-1-yl)-3-pyrrolidin-1-ylpropane-1,3-dione (PubChem CID 108942003) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-3-pyrrolidin-1-ylpropane-1,3-dione.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-3-pyrrolidin-1-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 108942003 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-3-pyrrolidin-1-ylpropane-1,3-dione |
| SMILES | O=C(CC(=O)N1CCC(Cc2ccccc2)CC1)N1CCCC1 |
| InChI | InChI=1S/C19H26N2O2/c22-18(20-10-4-5-11-20)15-19(23)21-12-8-17(9-13-21)14-16-6-2-1-3-7-16/h1-3,6-7,17H,4-5,8-15H2 |
| InChIKey | KFMWFRUKPNFDNH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|