About N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide
N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide (PubChem CID 108942351) has the molecular formula C13H22N2O4S
and a molecular weight of 302.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide.
Molecular Properties
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide |
| PubChem CID | 108942351 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide |
| SMILES | CN(C(=O)CC(=O)N1CCCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22N2O4S/c1-14(11-5-8-20(18,19)10-11)12(16)9-13(17)15-6-3-2-4-7-15/h11H,2-10H2,1H3 |
| InChIKey | ZCPQQHDAPAUIFC-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide?
The IUPAC name of N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide (CID 108942351) is N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide.
What is the SMILES notation for N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide?
The canonical SMILES for N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide is CN(C(=O)CC(=O)N1CCCCC1)C1CCS(=O)(=O)C1.
What is the InChIKey of N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide?
The InChIKey is ZCPQQHDAPAUIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O4S/c1-14(11-5-8-20(18,19)10-11)12(16)9-13(17)15-6-3-2-4-7-15/h11H,2-10H2,1H3.
What are the key properties of N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide?
N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide has a molecular weight of 302.40 g/mol, XLogP of 0.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothiolan-3-yl)-N-methyl-3-oxo-3-piperidin-1-ylpropanamide is sourced from PubChem (CID 108942351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).