C23H26O5 — CID 10894241
cis-dibenzyl (3S,4S)-3-(hydroxymethyl)-4-methylcyclopentane-1,1-dicarboxylate (PubChem CID 10894241) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is cis-dibenzyl (3S,4S)-3-(hydroxymethyl)-4-methylcyclopentane-1,1-dicarboxylate.
| Compound Name | cis-dibenzyl (3S,4S)-3-(hydroxymethyl)-4-methylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10894241 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | cis-dibenzyl (3S,4S)-3-(hydroxymethyl)-4-methylcyclopentane-1,1-dicarboxylate |
| SMILES | C[C@H]1CC(C(=O)OCc2ccccc2)(C(=O)OCc2ccccc2)C[C@@H]1CO |
| InChI | InChI=1S/C23H26O5/c1-17-12-23(13-20(17)14-24,21(25)27-15-18-8-4-2-5-9-18)22(26)28-16-19-10-6-3-7-11-19/h2-11,17,20,24H,12-16H2,1H3/t17-,20+/m0/s1 |
| InChIKey | HIPSGESKEWGCPR-FXAWDEMLSA-N |
| XLogP | 3.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|