C22H28ClNO3 — CID 10894424
(1S,2S)-1-(4-chloro-3-methoxyphenyl)-N-(2,2-dimethoxyethyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 10894424) has the molecular formula C22H28ClNO3 and a molecular weight of 389.92 g/mol. Its IUPAC name is (1S,2S)-1-(4-chloro-3-methoxyphenyl)-N-(2,2-dimethoxyethyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (1S,2S)-1-(4-chloro-3-methoxyphenyl)-N-(2,2-dimethoxyethyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 10894424 |
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (1S,2S)-1-(4-chloro-3-methoxyphenyl)-N-(2,2-dimethoxyethyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | COc1cc([C@H]2c3ccccc3CC[C@@H]2N(C)CC(OC)OC)ccc1Cl |
| InChI | InChI=1S/C22H28ClNO3/c1-24(14-21(26-3)27-4)19-12-10-15-7-5-6-8-17(15)22(19)16-9-11-18(23)20(13-16)25-2/h5-9,11,13,19,21-22H,10,12,14H2,1-4H3/t19-,22-/m0/s1 |
| InChIKey | LEIMDLVAMAFLQF-UGKGYDQZSA-N |
| XLogP | 4.35 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|