C14H20N4O2 — CID 108944337
3-(4-methylpiperazin-1-yl)-3-oxo-N-(pyridin-2-ylmethyl)propanamide (PubChem CID 108944337) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-3-oxo-N-(pyridin-2-ylmethyl)propanamide.
| Compound Name | 3-(4-methylpiperazin-1-yl)-3-oxo-N-(pyridin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 108944337 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-3-oxo-N-(pyridin-2-ylmethyl)propanamide |
| SMILES | CN1CCN(C(=O)CC(=O)NCc2ccccn2)CC1 |
| InChI | InChI=1S/C14H20N4O2/c1-17-6-8-18(9-7-17)14(20)10-13(19)16-11-12-4-2-3-5-15-12/h2-5H,6-11H2,1H3,(H,16,19) |
| InChIKey | PVJDVHSPPLEBAG-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|