C15H25N3O4 — CID 108944358
1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(4-methylpiperazin-1-yl)propane-1,3-dione (PubChem CID 108944358) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(4-methylpiperazin-1-yl)propane-1,3-dione.
| Compound Name | 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(4-methylpiperazin-1-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 108944358 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(4-methylpiperazin-1-yl)propane-1,3-dione |
| SMILES | CN1CCN(C(=O)CC(=O)N2CCC3(CC2)OCCO3)CC1 |
| InChI | InChI=1S/C15H25N3O4/c1-16-6-8-18(9-7-16)14(20)12-13(19)17-4-2-15(3-5-17)21-10-11-22-15/h2-12H2,1H3 |
| InChIKey | KPLBUXNMDDXGLP-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|