C15H20ClN3O2 — CID 108944418
N-(3-chloro-2-methylphenyl)-3-(4-methylpiperazin-1-yl)-3-oxopropanamide (PubChem CID 108944418) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-(4-methylpiperazin-1-yl)-3-oxopropanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-(4-methylpiperazin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108944418 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-(4-methylpiperazin-1-yl)-3-oxopropanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C15H20ClN3O2/c1-11-12(16)4-3-5-13(11)17-14(20)10-15(21)19-8-6-18(2)7-9-19/h3-5H,6-10H2,1-2H3,(H,17,20) |
| InChIKey | WDTZBZYZCTWHDY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|