C16H27N3O4 — CID 108944534
1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(4-ethylpiperazin-1-yl)propane-1,3-dione (PubChem CID 108944534) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(4-ethylpiperazin-1-yl)propane-1,3-dione.
| Compound Name | 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(4-ethylpiperazin-1-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 108944534 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(4-ethylpiperazin-1-yl)propane-1,3-dione |
| SMILES | CCN1CCN(C(=O)CC(=O)N2CCC3(CC2)OCCO3)CC1 |
| InChI | InChI=1S/C16H27N3O4/c1-2-17-7-9-19(10-8-17)15(21)13-14(20)18-5-3-16(4-6-18)22-11-12-23-16/h2-13H2,1H3 |
| InChIKey | LWUVXJNVRDCZRY-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|