C13H19F3O8S — CID 10894471
[(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] trifluoromethanesulfonate (PubChem CID 10894471) has the molecular formula C13H19F3O8S and a molecular weight of 392.35 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10894471 |
| Molecular Formula | C13H19F3O8S |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [(3aR,5S,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@H]2O[C@@H]([C@H]3COC(C)(C)O3)[C@@H](OS(=O)(=O)C(F)(F)F)[C@H]2O1 |
| InChI | InChI=1S/C13H19F3O8S/c1-11(2)19-5-6(21-11)7-8(24-25(17,18)13(14,15)16)9-10(20-7)23-12(3,4)22-9/h6-10H,5H2,1-4H3/t6-,7+,8-,9-,10-/m1/s1 |
| InChIKey | VVOYXQBDMGGDJZ-JDDHQFAOSA-N |
| XLogP | 1.25 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|