C20H27N3O3 — CID 10894510
3-[[2-[1-(2-piperidin-4-ylethyl)indol-3-yl]acetyl]amino]propanoic acid (PubChem CID 10894510) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-[[2-[1-(2-piperidin-4-ylethyl)indol-3-yl]acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-[1-(2-piperidin-4-ylethyl)indol-3-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10894510 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 3-[[2-[1-(2-piperidin-4-ylethyl)indol-3-yl]acetyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)Cc1cn(CCC2CCNCC2)c2ccccc12 |
| InChI | InChI=1S/C20H27N3O3/c24-19(22-11-7-20(25)26)13-16-14-23(18-4-2-1-3-17(16)18)12-8-15-5-9-21-10-6-15/h1-4,14-15,21H,5-13H2,(H,22,24)(H,25,26) |
| InChIKey | YHBUNYQIHYIGPT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |