C21H17NO5S — CID 10894541
1-[9-(benzenesulfonyl)-4-hydroxy-6-methoxycarbazol-3-yl]ethanone (PubChem CID 10894541) has the molecular formula C21H17NO5S and a molecular weight of 395.44 g/mol. Its IUPAC name is 1-[9-(benzenesulfonyl)-4-hydroxy-6-methoxycarbazol-3-yl]ethanone.
| Compound Name | 1-[9-(benzenesulfonyl)-4-hydroxy-6-methoxycarbazol-3-yl]ethanone |
|---|---|
| PubChem CID | 10894541 |
| Molecular Formula | C21H17NO5S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 1-[9-(benzenesulfonyl)-4-hydroxy-6-methoxycarbazol-3-yl]ethanone |
| SMILES | COc1ccc2c(c1)c1c(O)c(C(C)=O)ccc1n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H17NO5S/c1-13(23)16-9-11-19-20(21(16)24)17-12-14(27-2)8-10-18(17)22(19)28(25,26)15-6-4-3-5-7-15/h3-12,24H,1-2H3 |
| InChIKey | YQNNZLCEQVNCKC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |