C18H20N2O2 — CID 108945423
N'-(3-methylphenyl)-N-[(2-methylphenyl)methyl]propanediamide (PubChem CID 108945423) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N'-(3-methylphenyl)-N-[(2-methylphenyl)methyl]propanediamide.
| Compound Name | N'-(3-methylphenyl)-N-[(2-methylphenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 108945423 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N'-(3-methylphenyl)-N-[(2-methylphenyl)methyl]propanediamide |
| SMILES | Cc1cccc(NC(=O)CC(=O)NCc2ccccc2C)c1 |
| InChI | InChI=1S/C18H20N2O2/c1-13-6-5-9-16(10-13)20-18(22)11-17(21)19-12-15-8-4-3-7-14(15)2/h3-10H,11-12H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | NQOAQIUZZXYPJQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|