C18H22O8S — CID 10894597
[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-yl] acetate (PubChem CID 10894597) has the molecular formula C18H22O8S and a molecular weight of 398.43 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 10894597 |
| Molecular Formula | C18H22O8S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-(hydroxymethyl)-6-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](Sc2ccccc2)O[C@H](CO)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H22O8S/c1-10(20)23-15-14(9-19)26-18(27-13-7-5-4-6-8-13)17(25-12(3)22)16(15)24-11(2)21/h4-8,14-19H,9H2,1-3H3/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | DIVGTOCRLJGASM-SFFUCWETSA-N |
| XLogP | 1.29 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|