C16H13Cl2FN2O2 — CID 108946354
N'-(2,3-dichlorophenyl)-N-[(2-fluorophenyl)methyl]propanediamide (PubChem CID 108946354) has the molecular formula C16H13Cl2FN2O2 and a molecular weight of 355.20 g/mol. Its IUPAC name is N'-(2,3-dichlorophenyl)-N-[(2-fluorophenyl)methyl]propanediamide.
| Compound Name | N'-(2,3-dichlorophenyl)-N-[(2-fluorophenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 108946354 |
| Molecular Formula | C16H13Cl2FN2O2 |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | N'-(2,3-dichlorophenyl)-N-[(2-fluorophenyl)methyl]propanediamide |
| SMILES | O=C(CC(=O)Nc1cccc(Cl)c1Cl)NCc1ccccc1F |
| InChI | InChI=1S/C16H13Cl2FN2O2/c17-11-5-3-7-13(16(11)18)21-15(23)8-14(22)20-9-10-4-1-2-6-12(10)19/h1-7H,8-9H2,(H,20,22)(H,21,23) |
| InChIKey | FYPNTMOZHDZPDZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|