C22H34O3Si2 — CID 10894709
(1R,2S,6R)-2-[[[[(1R,2S,6R)-1-hydroxy-2-bicyclo[4.2.0]octa-4,7-dienyl]methyl-dimethylsilyl]oxy-dimethylsilyl]methyl]bicyclo[4.2.0]octa-4,7-dien-1-ol (PubChem CID 10894709) has the molecular formula C22H34O3Si2 and a molecular weight of 402.68 g/mol. Its IUPAC name is (1R,2S,6R)-2-[[[[(1R,2S,6R)-1-hydroxy-2-bicyclo[4.2.0]octa-4,7-dienyl]methyl-dimethylsilyl]oxy-dimethylsilyl]methyl]bicyclo[4.2.0]octa-4,7-dien-1-ol.
| Compound Name | (1R,2S,6R)-2-[[[[(1R,2S,6R)-1-hydroxy-2-bicyclo[4.2.0]octa-4,7-dienyl]methyl-dimethylsilyl]oxy-dimethylsilyl]methyl]bicyclo[4.2.0]octa-4,7-dien-1-ol |
|---|---|
| PubChem CID | 10894709 |
| Molecular Formula | C22H34O3Si2 |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (1R,2S,6R)-2-[[[[(1R,2S,6R)-1-hydroxy-2-bicyclo[4.2.0]octa-4,7-dienyl]methyl-dimethylsilyl]oxy-dimethylsilyl]methyl]bicyclo[4.2.0]octa-4,7-dien-1-ol |
| SMILES | C[Si](C)(C[C@H]1CC=C[C@@H]2C=C[C@@]21O)O[Si](C)(C)C[C@H]1CC=C[C@@H]2C=C[C@@]21O |
| InChI | InChI=1S/C22H34O3Si2/c1-26(2,15-19-9-5-7-17-11-13-21(17,19)23)25-27(3,4)16-20-10-6-8-18-12-14-22(18,20)24/h5-8,11-14,17-20,23-24H,9-10,15-16H2,1-4H3/t17-,18-,19-,20-,21-,22-/m1/s1 |
| InChIKey | ZKIZXFIOZKKFME-CGXUPHRESA-N |
| XLogP | 4.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|