C25H46O2Si — CID 10894795
[(4Z)-3-methylidene-4-(tributylsilylmethylidene)cyclopentyl]methyl 2,2-dimethylpropanoate (PubChem CID 10894795) has the molecular formula C25H46O2Si and a molecular weight of 406.73 g/mol. Its IUPAC name is [(4Z)-3-methylidene-4-(tributylsilylmethylidene)cyclopentyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(4Z)-3-methylidene-4-(tributylsilylmethylidene)cyclopentyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10894795 |
| Molecular Formula | C25H46O2Si |
| Molecular Weight | 406.73 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | [(4Z)-3-methylidene-4-(tributylsilylmethylidene)cyclopentyl]methyl 2,2-dimethylpropanoate |
| SMILES | C=C1CC(COC(=O)C(C)(C)C)C/C1=C/[Si](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C25H46O2Si/c1-8-11-14-28(15-12-9-2,16-13-10-3)20-23-18-22(17-21(23)4)19-27-24(26)25(5,6)7/h20,22H,4,8-19H2,1-3,5-7H3/b23-20- |
| InChIKey | QJVYCURDIIAKTD-ATJXCDBQSA-N |
| XLogP | 7.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.73 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|